C5H5ClN2O2 — CID 91516447
N-(chloromethyl)-1,2-oxazole-3-carboxamide (PubChem CID 91516447) has the molecular formula C5H5ClN2O2 and a molecular weight of 160.56 g/mol. Its IUPAC name is N-(chloromethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(chloromethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 91516447 |
| Molecular Formula | C5H5ClN2O2 |
| Molecular Weight | 160.56 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | N-(chloromethyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCl)c1ccon1 |
| InChI | InChI=1S/C5H5ClN2O2/c6-3-7-5(9)4-1-2-10-8-4/h1-2H,3H2,(H,7,9) |
| InChIKey | XWBFBJOBVTULIN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.56 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|