C11H9ClN2O2 — CID 114299970
N-[4-(chloromethyl)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 114299970) has the molecular formula C11H9ClN2O2 and a molecular weight of 236.66 g/mol. Its IUPAC name is N-[4-(chloromethyl)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[4-(chloromethyl)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 114299970 |
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | N-[4-(chloromethyl)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(CCl)cc1)c1ccon1 |
| InChI | InChI=1S/C11H9ClN2O2/c12-7-8-1-3-9(4-2-8)13-11(15)10-5-6-16-14-10/h1-6H,7H2,(H,13,15) |
| InChIKey | GPOBSWNLFNSJKQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|