5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid

C10H7N3O4 — CID 63154305

IUPAC5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid
SMILESO=C(O)c1cncc(NC(=O)c2ccon2)c1
InChIInChI=1S/C10H7N3O4/c14-9(8-1-2-17-13-8)12-7-3-6(10(15)16)4-11-5-7/h1-5H,(H,12,14)(H,15,16)
InChIKeyXBVWVHAXOMRCGD-UHFFFAOYSA-N
MW233.18 g/mol
LogP1.02
Rot. Bonds3

About 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid

5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid (PubChem CID 63154305) has the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. Its IUPAC name is 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid
PubChem CID63154305
Molecular FormulaC10H7N3O4
Molecular Weight233.18 g/mol
Exact Mass233.04
IUPAC Name5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid
SMILESO=C(O)c1cncc(NC(=O)c2ccon2)c1
InChIInChI=1S/C10H7N3O4/c14-9(8-1-2-17-13-8)12-7-3-6(10(15)16)4-11-5-7/h1-5H,(H,12,14)(H,15,16)
InChIKeyXBVWVHAXOMRCGD-UHFFFAOYSA-N
XLogP1.02
TPSA105.32 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.18
LogP ≤ 51.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid?
The IUPAC name of 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid (CID 63154305) is 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid?
The canonical SMILES for 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid is O=C(O)c1cncc(NC(=O)c2ccon2)c1.
What is the InChIKey of 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid?
The InChIKey is XBVWVHAXOMRCGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O4/c14-9(8-1-2-17-13-8)12-7-3-6(10(15)16)4-11-5-7/h1-5H,(H,12,14)(H,15,16).
What are the key properties of 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid?
5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid has a molecular weight of 233.18 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-oxazole-3-carbonylamino)pyridine-3-carboxylic acid is sourced from PubChem (CID 63154305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).