C11H8N4O3 — CID 104669628
5-(pyridazine-4-carbonylamino)pyridine-3-carboxylic acid (PubChem CID 104669628) has the molecular formula C11H8N4O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is 5-(pyridazine-4-carbonylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-(pyridazine-4-carbonylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 104669628 |
| Molecular Formula | C11H8N4O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 5-(pyridazine-4-carbonylamino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(NC(=O)c2ccnnc2)c1 |
| InChI | InChI=1S/C11H8N4O3/c16-10(7-1-2-13-14-5-7)15-9-3-8(11(17)18)4-12-6-9/h1-6H,(H,15,16)(H,17,18) |
| InChIKey | XKUCTTNMWMBRNN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |