C11H8N4O5 — CID 63153896
5-[(5-nitro-1H-pyrrole-2-carbonyl)amino]pyridine-3-carboxylic acid (PubChem CID 63153896) has the molecular formula C11H8N4O5 and a molecular weight of 276.21 g/mol. Its IUPAC name is 5-[(5-nitro-1H-pyrrole-2-carbonyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 5-[(5-nitro-1H-pyrrole-2-carbonyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63153896 |
| Molecular Formula | C11H8N4O5 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 5-[(5-nitro-1H-pyrrole-2-carbonyl)amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(NC(=O)c2ccc([N+](=O)[O-])[nH]2)c1 |
| InChI | InChI=1S/C11H8N4O5/c16-10(8-1-2-9(14-8)15(19)20)13-7-3-6(11(17)18)4-12-5-7/h1-5,14H,(H,13,16)(H,17,18) |
| InChIKey | RDRANOBZUSXTFT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|