C8H5BrN4O3S — CID 60785600
N-(5-bromo-1,3-thiazol-2-yl)-5-nitro-1H-pyrrole-2-carboxamide (PubChem CID 60785600) has the molecular formula C8H5BrN4O3S and a molecular weight of 317.12 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-5-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-5-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60785600 |
| Molecular Formula | C8H5BrN4O3S |
| Molecular Weight | 317.12 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-5-nitro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ncc(Br)s1)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C8H5BrN4O3S/c9-5-3-10-8(17-5)12-7(14)4-1-2-6(11-4)13(15)16/h1-3,11H,(H,10,12,14) |
| InChIKey | JRVFNNFXPPOCTR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.12 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|