C11H7BrFN3O3S — CID 103297178
N-(5-bromo-1,3-thiazol-2-yl)-2-fluoro-3-methyl-5-nitrobenzamide (PubChem CID 103297178) has the molecular formula C11H7BrFN3O3S and a molecular weight of 360.16 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-2-fluoro-3-methyl-5-nitrobenzamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-2-fluoro-3-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 103297178 |
| Molecular Formula | C11H7BrFN3O3S |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 358.94 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-2-fluoro-3-methyl-5-nitrobenzamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(C(=O)Nc2ncc(Br)s2)c1F |
| InChI | InChI=1S/C11H7BrFN3O3S/c1-5-2-6(16(18)19)3-7(9(5)13)10(17)15-11-14-4-8(12)20-11/h2-4H,1H3,(H,14,15,17) |
| InChIKey | JCLDUJBLTMAGDD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|