C10H9BrN4O3S — CID 60783546
N-(5-bromo-1,3-thiazol-2-yl)-1-ethyl-4-nitropyrrole-2-carboxamide (PubChem CID 60783546) has the molecular formula C10H9BrN4O3S and a molecular weight of 345.18 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-1-ethyl-4-nitropyrrole-2-carboxamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-1-ethyl-4-nitropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60783546 |
| Molecular Formula | C10H9BrN4O3S |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-1-ethyl-4-nitropyrrole-2-carboxamide |
| SMILES | CCn1cc([N+](=O)[O-])cc1C(=O)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C10H9BrN4O3S/c1-2-14-5-6(15(17)18)3-7(14)9(16)13-10-12-4-8(11)19-10/h3-5H,2H2,1H3,(H,12,13,16) |
| InChIKey | LSPFAYRSGBRTEQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|