C11H11BrN4O3S — CID 60954776
4-bromo-N-(5-nitro-1,3-thiazol-2-yl)-1-propylpyrrole-2-carboxamide (PubChem CID 60954776) has the molecular formula C11H11BrN4O3S and a molecular weight of 359.21 g/mol. Its IUPAC name is 4-bromo-N-(5-nitro-1,3-thiazol-2-yl)-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(5-nitro-1,3-thiazol-2-yl)-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60954776 |
| Molecular Formula | C11H11BrN4O3S |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 4-bromo-N-(5-nitro-1,3-thiazol-2-yl)-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H11BrN4O3S/c1-2-3-15-6-7(12)4-8(15)10(17)14-11-13-5-9(20-11)16(18)19/h4-6H,2-3H2,1H3,(H,13,14,17) |
| InChIKey | AGOVQQDPHDBEOX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|