C8H9N3O5S — CID 110480880
ethyl 3-[(5-nitro-1,3-thiazol-2-yl)amino]-3-oxopropanoate (PubChem CID 110480880) has the molecular formula C8H9N3O5S and a molecular weight of 259.24 g/mol. Its IUPAC name is ethyl 3-[(5-nitro-1,3-thiazol-2-yl)amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[(5-nitro-1,3-thiazol-2-yl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 110480880 |
| Molecular Formula | C8H9N3O5S |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | ethyl 3-[(5-nitro-1,3-thiazol-2-yl)amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H9N3O5S/c1-2-16-7(13)3-5(12)10-8-9-4-6(17-8)11(14)15/h4H,2-3H2,1H3,(H,9,10,12) |
| InChIKey | SCSGRVGXHDDUDM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|