C19H33N3O5SSn — CID 139239847
tributylstannyl 4-[(5-nitro-1,3-thiazol-2-yl)amino]-4-oxobutanoate (PubChem CID 139239847) has the molecular formula C19H33N3O5SSn and a molecular weight of 534.27 g/mol. Its IUPAC name is tributylstannyl 4-[(5-nitro-1,3-thiazol-2-yl)amino]-4-oxobutanoate.
| Compound Name | tributylstannyl 4-[(5-nitro-1,3-thiazol-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 139239847 |
| Molecular Formula | C19H33N3O5SSn |
| Molecular Weight | 534.27 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | tributylstannyl 4-[(5-nitro-1,3-thiazol-2-yl)amino]-4-oxobutanoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)OC(=O)CCC(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C7H7N3O5S.3C4H9.Sn/c11-4(1-2-6(12)13)9-7-8-3-5(16-7)10(14)15;3*1-3-4-2;/h3H,1-2H2,(H,12,13)(H,8,9,11);3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | OZRIHXMNZXQRHD-UHFFFAOYSA-M |
| XLogP | 5.66 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.27 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|