C10H9N5O4S2 — CID 22678801
2-(2-acetamido-1,3-thiazol-4-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide (PubChem CID 22678801) has the molecular formula C10H9N5O4S2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 2-(2-acetamido-1,3-thiazol-4-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2-acetamido-1,3-thiazol-4-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 22678801 |
| Molecular Formula | C10H9N5O4S2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-(2-acetamido-1,3-thiazol-4-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc(CC(=O)Nc2ncc([N+](=O)[O-])s2)cs1 |
| InChI | InChI=1S/C10H9N5O4S2/c1-5(16)12-10-13-6(4-20-10)2-7(17)14-9-11-3-8(21-9)15(18)19/h3-4H,2H2,1H3,(H,11,14,17)(H,12,13,16) |
| InChIKey | AXPVHYJAVIPBRV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|