C5H5N3NaO6S3+ — CID 126460340
sodium 5-nitro-2-[(2-sulfosulfanylacetyl)amino]-1,3-thiazole (PubChem CID 126460340) has the molecular formula C5H5N3NaO6S3+ and a molecular weight of 322.30 g/mol. Its IUPAC name is sodium 5-nitro-2-[(2-sulfosulfanylacetyl)amino]-1,3-thiazole.
| Compound Name | sodium 5-nitro-2-[(2-sulfosulfanylacetyl)amino]-1,3-thiazole |
|---|---|
| PubChem CID | 126460340 |
| Molecular Formula | C5H5N3NaO6S3+ |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | sodium 5-nitro-2-[(2-sulfosulfanylacetyl)amino]-1,3-thiazole |
| SMILES | O=C(CSS(=O)(=O)O)Nc1ncc([N+](=O)[O-])s1.[Na+] |
| InChI | InChI=1S/C5H5N3O6S3.Na/c9-3(2-15-17(12,13)14)7-5-6-1-4(16-5)8(10)11;/h1H,2H2,(H,6,7,9)(H,12,13,14);/q;+1 |
| InChIKey | VDSPSHSJPUGBBV-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|