C14H13ClN4O6S2 — CID 15741049
N'-(4-chlorophenyl)sulfonyl-N-(5-nitro-1,3-thiazol-2-yl)pentanediamide (PubChem CID 15741049) has the molecular formula C14H13ClN4O6S2 and a molecular weight of 432.87 g/mol. Its IUPAC name is N'-(4-chlorophenyl)sulfonyl-N-(5-nitro-1,3-thiazol-2-yl)pentanediamide.
| Compound Name | N'-(4-chlorophenyl)sulfonyl-N-(5-nitro-1,3-thiazol-2-yl)pentanediamide |
|---|---|
| PubChem CID | 15741049 |
| Molecular Formula | C14H13ClN4O6S2 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | N'-(4-chlorophenyl)sulfonyl-N-(5-nitro-1,3-thiazol-2-yl)pentanediamide |
| SMILES | O=C(CCCC(=O)NS(=O)(=O)c1ccc(Cl)cc1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H13ClN4O6S2/c15-9-4-6-10(7-5-9)27(24,25)18-12(21)3-1-2-11(20)17-14-16-8-13(26-14)19(22)23/h4-8H,1-3H2,(H,18,21)(H,16,17,20) |
| InChIKey | QRXSBQAMDPMTOJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 148.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|