C13H14N4O5S2 — CID 175100933
N-(5-nitro-1,3-thiazol-2-yl)-4-(phenylsulfamoyl)butanamide (PubChem CID 175100933) has the molecular formula C13H14N4O5S2 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(5-nitro-1,3-thiazol-2-yl)-4-(phenylsulfamoyl)butanamide.
| Compound Name | N-(5-nitro-1,3-thiazol-2-yl)-4-(phenylsulfamoyl)butanamide |
|---|---|
| PubChem CID | 175100933 |
| Molecular Formula | C13H14N4O5S2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-(5-nitro-1,3-thiazol-2-yl)-4-(phenylsulfamoyl)butanamide |
| SMILES | O=C(CCCS(=O)(=O)Nc1ccccc1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H14N4O5S2/c18-11(15-13-14-9-12(23-13)17(19)20)7-4-8-24(21,22)16-10-5-2-1-3-6-10/h1-3,5-6,9,16H,4,7-8H2,(H,14,15,18) |
| InChIKey | BDFIEWJFBUQOPX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|