C20H16N8O5S3 — CID 165060570
1-(5-nitro-1,3-thiazol-2-yl)-3-phenylthiourea;1-(5-nitro-1,3-thiazol-2-yl)-3-phenylurea (PubChem CID 165060570) has the molecular formula C20H16N8O5S3 and a molecular weight of 544.60 g/mol. Its IUPAC name is 1-(5-nitro-1,3-thiazol-2-yl)-3-phenylthiourea;1-(5-nitro-1,3-thiazol-2-yl)-3-phenylurea.
| Compound Name | 1-(5-nitro-1,3-thiazol-2-yl)-3-phenylthiourea;1-(5-nitro-1,3-thiazol-2-yl)-3-phenylurea |
|---|---|
| PubChem CID | 165060570 |
| Molecular Formula | C20H16N8O5S3 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | 1-(5-nitro-1,3-thiazol-2-yl)-3-phenylthiourea;1-(5-nitro-1,3-thiazol-2-yl)-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ncc([N+](=O)[O-])s1.O=[N+]([O-])c1cnc(NC(=S)Nc2ccccc2)s1 |
| InChI | InChI=1S/C10H8N4O3S.C10H8N4O2S2/c15-9(12-7-4-2-1-3-5-7)13-10-11-6-8(18-10)14(16)17;15-14(16)8-6-11-10(18-8)13-9(17)12-7-4-2-1-3-5-7/h1-6H,(H2,11,12,13,15);1-6H,(H2,11,12,13,17) |
| InChIKey | RCYYSEMDYOSOJW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|