C16H12N6O3S2 — CID 5022227
4-nitro-N-[5-(phenylcarbamothioylamino)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 5022227) has the molecular formula C16H12N6O3S2 and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-nitro-N-[5-(phenylcarbamothioylamino)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-nitro-N-[5-(phenylcarbamothioylamino)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 5022227 |
| Molecular Formula | C16H12N6O3S2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 4-nitro-N-[5-(phenylcarbamothioylamino)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(NC(=S)Nc2ccccc2)s1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12N6O3S2/c23-13(10-6-8-12(9-7-10)22(24)25)18-15-20-21-16(27-15)19-14(26)17-11-4-2-1-3-5-11/h1-9H,(H,18,20,23)(H2,17,19,21,26) |
| InChIKey | URNKCAKIDWQYGA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|