C22H15N5O4S — CID 45018627
3-[(4-nitrobenzoyl)amino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 45018627) has the molecular formula C22H15N5O4S and a molecular weight of 445.46 g/mol. Its IUPAC name is 3-[(4-nitrobenzoyl)amino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-[(4-nitrobenzoyl)amino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 45018627 |
| Molecular Formula | C22H15N5O4S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 3-[(4-nitrobenzoyl)amino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2nnc(-c3ccccc3)s2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H15N5O4S/c28-19(14-9-11-18(12-10-14)27(30)31)23-17-8-4-7-16(13-17)20(29)24-22-26-25-21(32-22)15-5-2-1-3-6-15/h1-13H,(H,23,28)(H,24,26,29) |
| InChIKey | MIAALIRJKGUJSH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|