C22H15N5O5S — CID 45014096
2-hydroxy-N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide (PubChem CID 45014096) has the molecular formula C22H15N5O5S and a molecular weight of 461.46 g/mol. Its IUPAC name is 2-hydroxy-N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide.
| Compound Name | 2-hydroxy-N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 45014096 |
| Molecular Formula | C22H15N5O5S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-hydroxy-N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1nnc(-c2ccc([N+](=O)[O-])cc2)s1)c1cccc(NC(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C22H15N5O5S/c28-18-7-2-1-6-17(18)20(30)23-15-5-3-4-14(12-15)19(29)24-22-26-25-21(33-22)13-8-10-16(11-9-13)27(31)32/h1-12,28H,(H,23,30)(H,24,26,29) |
| InChIKey | DMOXNOZVVVRGLM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|