C22H17N5O6S2 — CID 45019416
N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-[(2-nitrophenyl)sulfonylamino]benzamide (PubChem CID 45019416) has the molecular formula C22H17N5O6S2 and a molecular weight of 511.54 g/mol. Its IUPAC name is N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-[(2-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-[(2-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 45019416 |
| Molecular Formula | C22H17N5O6S2 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-[(2-nitrophenyl)sulfonylamino]benzamide |
| SMILES | COc1ccc(-c2nnc(NC(=O)c3cccc(NS(=O)(=O)c4ccccc4[N+](=O)[O-])c3)s2)cc1 |
| InChI | InChI=1S/C22H17N5O6S2/c1-33-17-11-9-14(10-12-17)21-24-25-22(34-21)23-20(28)15-5-4-6-16(13-15)26-35(31,32)19-8-3-2-7-18(19)27(29)30/h2-13,26H,1H3,(H,23,25,28) |
| InChIKey | NZLFHDCVWJVOCE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 153.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|