C29H23N3O4S2 — CID 121043163
N-(4,5-diphenyl-1,3-thiazol-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzamide (PubChem CID 121043163) has the molecular formula C29H23N3O4S2 and a molecular weight of 541.65 g/mol. Its IUPAC name is N-(4,5-diphenyl-1,3-thiazol-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121043163 |
| Molecular Formula | C29H23N3O4S2 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc(C(=O)Nc3nc(-c4ccccc4)c(-c4ccccc4)s3)c2)cc1 |
| InChI | InChI=1S/C29H23N3O4S2/c1-36-24-15-17-25(18-16-24)38(34,35)32-23-14-8-13-22(19-23)28(33)31-29-30-26(20-9-4-2-5-10-20)27(37-29)21-11-6-3-7-12-21/h2-19,32H,1H3,(H,30,31,33) |
| InChIKey | SWOZJXVZNLNBMI-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |