C25H19N3O4S2 — CID 121043145
N-benzo[g][1,3]benzothiazol-2-yl-3-[(4-methoxyphenyl)sulfonylamino]benzamide (PubChem CID 121043145) has the molecular formula C25H19N3O4S2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-benzo[g][1,3]benzothiazol-2-yl-3-[(4-methoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-benzo[g][1,3]benzothiazol-2-yl-3-[(4-methoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121043145 |
| Molecular Formula | C25H19N3O4S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | N-benzo[g][1,3]benzothiazol-2-yl-3-[(4-methoxyphenyl)sulfonylamino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc(C(=O)Nc3nc4ccc5ccccc5c4s3)c2)cc1 |
| InChI | InChI=1S/C25H19N3O4S2/c1-32-19-10-12-20(13-11-19)34(30,31)28-18-7-4-6-17(15-18)24(29)27-25-26-22-14-9-16-5-2-3-8-21(16)23(22)33-25/h2-15,28H,1H3,(H,26,27,29) |
| InChIKey | KISBDOIFNJOOST-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |