C23H18IN3O4S2 — CID 121043159
N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-3-[(4-methoxyphenyl)sulfonylamino]benzamide (PubChem CID 121043159) has the molecular formula C23H18IN3O4S2 and a molecular weight of 591.45 g/mol. Its IUPAC name is N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-3-[(4-methoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-3-[(4-methoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121043159 |
| Molecular Formula | C23H18IN3O4S2 |
| Molecular Weight | 591.45 g/mol |
| Exact Mass | 590.98 |
| IUPAC Name | N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-3-[(4-methoxyphenyl)sulfonylamino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc(C(=O)Nc3nc(-c4ccc(I)cc4)cs3)c2)cc1 |
| InChI | InChI=1S/C23H18IN3O4S2/c1-31-19-9-11-20(12-10-19)33(29,30)27-18-4-2-3-16(13-18)22(28)26-23-25-21(14-32-23)15-5-7-17(24)8-6-15/h2-14,27H,1H3,(H,25,26,28) |
| InChIKey | HUHVDOWCDIQIHB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|