C22H18N4O7S2 — CID 121043147
N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzamide (PubChem CID 121043147) has the molecular formula C22H18N4O7S2 and a molecular weight of 514.54 g/mol. Its IUPAC name is N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121043147 |
| Molecular Formula | C22H18N4O7S2 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc(C(=O)Nc3nc4c(OC)cc([N+](=O)[O-])cc4s3)c2)cc1 |
| InChI | InChI=1S/C22H18N4O7S2/c1-32-16-6-8-17(9-7-16)35(30,31)25-14-5-3-4-13(10-14)21(27)24-22-23-20-18(33-2)11-15(26(28)29)12-19(20)34-22/h3-12,25H,1-2H3,(H,23,24,27) |
| InChIKey | UABZYNXRRYPOOQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 149.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|