C15H6F5N3O4S — CID 17177151
2,3,4,5,6-pentafluoro-N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 17177151) has the molecular formula C15H6F5N3O4S and a molecular weight of 419.29 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 17177151 |
| Molecular Formula | C15H6F5N3O4S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | COc1cc([N+](=O)[O-])cc2sc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)nc12 |
| InChI | InChI=1S/C15H6F5N3O4S/c1-27-5-2-4(23(25)26)3-6-13(5)21-15(28-6)22-14(24)7-8(16)10(18)12(20)11(19)9(7)17/h2-3H,1H3,(H,21,22,24) |
| InChIKey | IYFXBFODEGJCBK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|