C18H17N3O5S — CID 17177238
2-(2,4-dimethylphenoxy)-N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 17177238) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17177238 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-(4-methoxy-6-nitro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])cc2sc(NC(=O)COc3ccc(C)cc3C)nc12 |
| InChI | InChI=1S/C18H17N3O5S/c1-10-4-5-13(11(2)6-10)26-9-16(22)19-18-20-17-14(25-3)7-12(21(23)24)8-15(17)27-18/h4-8H,9H2,1-3H3,(H,19,20,22) |
| InChIKey | QFJYSMKVRGFDHQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|