C23H21N3O5S2 — CID 46325720
N-[6-[(4-ethoxyphenyl)sulfonylamino]-4-methoxy-1,3-benzothiazol-2-yl]benzamide (PubChem CID 46325720) has the molecular formula C23H21N3O5S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[6-[(4-ethoxyphenyl)sulfonylamino]-4-methoxy-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | N-[6-[(4-ethoxyphenyl)sulfonylamino]-4-methoxy-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46325720 |
| Molecular Formula | C23H21N3O5S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | N-[6-[(4-ethoxyphenyl)sulfonylamino]-4-methoxy-1,3-benzothiazol-2-yl]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc(OC)c3nc(NC(=O)c4ccccc4)sc3c2)cc1 |
| InChI | InChI=1S/C23H21N3O5S2/c1-3-31-17-9-11-18(12-10-17)33(28,29)26-16-13-19(30-2)21-20(14-16)32-23(24-21)25-22(27)15-7-5-4-6-8-15/h4-14,26H,3H2,1-2H3,(H,24,25,27) |
| InChIKey | YORHRDSXLXPWDA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |