C19H17N5O5S — CID 3558728
N-[1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide (PubChem CID 3558728) has the molecular formula C19H17N5O5S and a molecular weight of 427.44 g/mol. Its IUPAC name is N-[1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3558728 |
| Molecular Formula | C19H17N5O5S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide |
| SMILES | COc1ccc(-c2nnc(NC(=O)C(C)NC(=O)c3cccc([N+](=O)[O-])c3)s2)cc1 |
| InChI | InChI=1S/C19H17N5O5S/c1-11(20-17(26)13-4-3-5-14(10-13)24(27)28)16(25)21-19-23-22-18(30-19)12-6-8-15(29-2)9-7-12/h3-11H,1-2H3,(H,20,26)(H,21,23,25) |
| InChIKey | VYFMGVGZYCHJHG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|