C26H24N6O4S — CID 3663604
N-[1-[[5-[4-(dimethylamino)phenyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-3-nitrobenzamide (PubChem CID 3663604) has the molecular formula C26H24N6O4S and a molecular weight of 516.58 g/mol. Its IUPAC name is N-[1-[[5-[4-(dimethylamino)phenyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[1-[[5-[4-(dimethylamino)phenyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3663604 |
| Molecular Formula | C26H24N6O4S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | N-[1-[[5-[4-(dimethylamino)phenyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-3-nitrobenzamide |
| SMILES | CN(C)c1ccc(-c2nnc(NC(=O)C(Cc3ccccc3)NC(=O)c3cccc([N+](=O)[O-])c3)s2)cc1 |
| InChI | InChI=1S/C26H24N6O4S/c1-31(2)20-13-11-18(12-14-20)25-29-30-26(37-25)28-24(34)22(15-17-7-4-3-5-8-17)27-23(33)19-9-6-10-21(16-19)32(35)36/h3-14,16,22H,15H2,1-2H3,(H,27,33)(H,28,30,34) |
| InChIKey | WSDGDNPQTWFXMO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|