C24H18ClN5O4S — CID 93099979
N-[(2R)-1-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-nitrobenzamide (PubChem CID 93099979) has the molecular formula C24H18ClN5O4S and a molecular weight of 507.96 g/mol. Its IUPAC name is N-[(2R)-1-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-nitrobenzamide.
| Compound Name | N-[(2R)-1-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 93099979 |
| Molecular Formula | C24H18ClN5O4S |
| Molecular Weight | 507.96 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | N-[(2R)-1-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-nitrobenzamide |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)Nc1nnc(-c2ccc(Cl)cc2)s1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H18ClN5O4S/c25-18-10-6-17(7-11-18)23-28-29-24(35-23)27-22(32)20(14-15-4-2-1-3-5-15)26-21(31)16-8-12-19(13-9-16)30(33)34/h1-13,20H,14H2,(H,26,31)(H,27,29,32)/t20-/m1/s1 |
| InChIKey | MQXWFIVNQZUHSA-HXUWFJFHSA-N |
| XLogP | 4.75 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.96 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|