C24H28N4O3S — CID 4609382
N-[1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-4-pentylbenzamide (PubChem CID 4609382) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-[1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-4-pentylbenzamide.
| Compound Name | N-[1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 4609382 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-[1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)NC(C)C(=O)Nc2nnc(-c3ccc(OC)cc3)s2)cc1 |
| InChI | InChI=1S/C24H28N4O3S/c1-4-5-6-7-17-8-10-18(11-9-17)22(30)25-16(2)21(29)26-24-28-27-23(32-24)19-12-14-20(31-3)15-13-19/h8-16H,4-7H2,1-3H3,(H,25,30)(H,26,28,29) |
| InChIKey | SARKCWFDLZYSJE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|