C19H26N4O3S — CID 7327009
N-[(2R)-1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]heptanamide (PubChem CID 7327009) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[(2R)-1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]heptanamide.
| Compound Name | N-[(2R)-1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]heptanamide |
|---|---|
| PubChem CID | 7327009 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[(2R)-1-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)N[C@H](C)C(=O)Nc1nnc(-c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C19H26N4O3S/c1-4-5-6-7-8-16(24)20-13(2)17(25)21-19-23-22-18(27-19)14-9-11-15(26-3)12-10-14/h9-13H,4-8H2,1-3H3,(H,20,24)(H,21,23,25)/t13-/m1/s1 |
| InChIKey | ONKTXANACYINTA-CYBMUJFWSA-N |
| XLogP | 3.63 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|