C21H30N4O2S — CID 5236860
N-[3-methyl-1-oxo-1-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]pentan-2-yl]heptanamide (PubChem CID 5236860) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-[3-methyl-1-oxo-1-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]pentan-2-yl]heptanamide.
| Compound Name | N-[3-methyl-1-oxo-1-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]pentan-2-yl]heptanamide |
|---|---|
| PubChem CID | 5236860 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[3-methyl-1-oxo-1-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]pentan-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)NC(C(=O)Nc1nnc(-c2ccccc2)s1)C(C)CC |
| InChI | InChI=1S/C21H30N4O2S/c1-4-6-7-11-14-17(26)22-18(15(3)5-2)19(27)23-21-25-24-20(28-21)16-12-9-8-10-13-16/h8-10,12-13,15,18H,4-7,11,14H2,1-3H3,(H,22,26)(H,23,25,27) |
| InChIKey | IFJFZGVZZQAYAT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|