C22H31ClN4O2S — CID 4679515
N-[1-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]octanamide (PubChem CID 4679515) has the molecular formula C22H31ClN4O2S and a molecular weight of 451.04 g/mol. Its IUPAC name is N-[1-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]octanamide.
| Compound Name | N-[1-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]octanamide |
|---|---|
| PubChem CID | 4679515 |
| Molecular Formula | C22H31ClN4O2S |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[1-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)NC(C(=O)Nc1nnc(-c2ccc(Cl)cc2)s1)C(C)CC |
| InChI | InChI=1S/C22H31ClN4O2S/c1-4-6-7-8-9-10-18(28)24-19(15(3)5-2)20(29)25-22-27-26-21(30-22)16-11-13-17(23)14-12-16/h11-15,19H,4-10H2,1-3H3,(H,24,28)(H,25,27,29) |
| InChIKey | XAKQLNGTXOKGCJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|