C23H33FN4O2S — CID 5033038
N-[1-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]nonanamide (PubChem CID 5033038) has the molecular formula C23H33FN4O2S and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[1-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]nonanamide.
| Compound Name | N-[1-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]nonanamide |
|---|---|
| PubChem CID | 5033038 |
| Molecular Formula | C23H33FN4O2S |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | N-[1-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]nonanamide |
| SMILES | CCCCCCCCC(=O)NC(C(=O)Nc1nnc(-c2ccc(F)cc2)s1)C(C)CC |
| InChI | InChI=1S/C23H33FN4O2S/c1-4-6-7-8-9-10-11-19(29)25-20(16(3)5-2)21(30)26-23-28-27-22(31-23)17-12-14-18(24)15-13-17/h12-16,20H,4-11H2,1-3H3,(H,25,29)(H,26,28,30) |
| InChIKey | JURCYFFINYQXOG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|