C22H30N4O4S — CID 4242285
N-[1-[[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]heptanamide (PubChem CID 4242285) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[1-[[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]heptanamide.
| Compound Name | N-[1-[[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]heptanamide |
|---|---|
| PubChem CID | 4242285 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[1-[[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)NC(C(=O)Nc1nnc(-c2ccc3c(c2)OCO3)s1)C(C)CC |
| InChI | InChI=1S/C22H30N4O4S/c1-4-6-7-8-9-18(27)23-19(14(3)5-2)20(28)24-22-26-25-21(31-22)15-10-11-16-17(12-15)30-13-29-16/h10-12,14,19H,4-9,13H2,1-3H3,(H,23,27)(H,24,26,28) |
| InChIKey | QEHCBHFZKTVLGG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|