C21H29N5O4S — CID 5001245
2-(6-aminohexanoylamino)-N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-3-methylpentanamide (PubChem CID 5001245) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-(6-aminohexanoylamino)-N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-3-methylpentanamide.
| Compound Name | 2-(6-aminohexanoylamino)-N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 5001245 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-(6-aminohexanoylamino)-N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-3-methylpentanamide |
| SMILES | CCC(C)C(NC(=O)CCCCCN)C(=O)Nc1nnc(-c2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C21H29N5O4S/c1-3-13(2)18(23-17(27)7-5-4-6-10-22)19(28)24-21-26-25-20(31-21)14-8-9-15-16(11-14)30-12-29-15/h8-9,11,13,18H,3-7,10,12,22H2,1-2H3,(H,23,27)(H,24,26,28) |
| InChIKey | YZXDJUVBOBMWAL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|