C22H32N4O2S — CID 7283084
N-[(2S,3R)-3-methyl-1-[[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopentan-2-yl]heptanamide (PubChem CID 7283084) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is N-[(2S,3R)-3-methyl-1-[[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopentan-2-yl]heptanamide.
| Compound Name | N-[(2S,3R)-3-methyl-1-[[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopentan-2-yl]heptanamide |
|---|---|
| PubChem CID | 7283084 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[(2S,3R)-3-methyl-1-[[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxopentan-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)N[C@H](C(=O)Nc1nnc(-c2ccc(C)cc2)s1)[C@H](C)CC |
| InChI | InChI=1S/C22H32N4O2S/c1-5-7-8-9-10-18(27)23-19(16(4)6-2)20(28)24-22-26-25-21(29-22)17-13-11-15(3)12-14-17/h11-14,16,19H,5-10H2,1-4H3,(H,23,27)(H,24,26,28)/t16-,19+/m1/s1 |
| InChIKey | FLMZJJINRVECKR-APWZRJJASA-N |
| XLogP | 4.95 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|