C24H36N4O3S — CID 4285184
N-butan-2-yl-N-[3-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]octanamide (PubChem CID 4285184) has the molecular formula C24H36N4O3S and a molecular weight of 460.64 g/mol. Its IUPAC name is N-butan-2-yl-N-[3-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]octanamide.
| Compound Name | N-butan-2-yl-N-[3-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]octanamide |
|---|---|
| PubChem CID | 4285184 |
| Molecular Formula | C24H36N4O3S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-butan-2-yl-N-[3-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]octanamide |
| SMILES | CCCCCCCC(=O)N(CCC(=O)Nc1nnc(-c2ccc(OC)cc2)s1)C(C)CC |
| InChI | InChI=1S/C24H36N4O3S/c1-5-7-8-9-10-11-22(30)28(18(3)6-2)17-16-21(29)25-24-27-26-23(32-24)19-12-14-20(31-4)15-13-19/h12-15,18H,5-11,16-17H2,1-4H3,(H,25,27,29) |
| InChIKey | PTZKPVHPEZTVOP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|