C22H31ClN4O2S — CID 93010886
N-[(2R)-butan-2-yl]-N-[3-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]heptanamide (PubChem CID 93010886) has the molecular formula C22H31ClN4O2S and a molecular weight of 451.04 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-N-[3-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]heptanamide.
| Compound Name | N-[(2R)-butan-2-yl]-N-[3-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]heptanamide |
|---|---|
| PubChem CID | 93010886 |
| Molecular Formula | C22H31ClN4O2S |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[(2R)-butan-2-yl]-N-[3-[[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]heptanamide |
| SMILES | CCCCCCC(=O)N(CCC(=O)Nc1nnc(-c2ccc(Cl)cc2)s1)[C@H](C)CC |
| InChI | InChI=1S/C22H31ClN4O2S/c1-4-6-7-8-9-20(29)27(16(3)5-2)15-14-19(28)24-22-26-25-21(30-22)17-10-12-18(23)13-11-17/h10-13,16H,4-9,14-15H2,1-3H3,(H,24,26,28)/t16-/m1/s1 |
| InChIKey | SERFQQRZVLBMNQ-MRXNPFEDSA-N |
| XLogP | 5.78 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|