C22H13Cl2N5O4S — CID 45016467
2,4-dichloro-N-[2-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide (PubChem CID 45016467) has the molecular formula C22H13Cl2N5O4S and a molecular weight of 514.35 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 45016467 |
| Molecular Formula | C22H13Cl2N5O4S |
| Molecular Weight | 514.35 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | 2,4-dichloro-N-[2-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)Nc1nnc(-c2ccc([N+](=O)[O-])cc2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H13Cl2N5O4S/c23-13-7-10-15(17(24)11-13)19(30)25-18-4-2-1-3-16(18)20(31)26-22-28-27-21(34-22)12-5-8-14(9-6-12)29(32)33/h1-11H,(H,25,30)(H,26,28,31) |
| InChIKey | VPFHSOFQQVQWEV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.35 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|