C22H12Cl2FN3O3S — CID 126057492
2,4-dichloro-N-[4-(4-fluorophenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 126057492) has the molecular formula C22H12Cl2FN3O3S and a molecular weight of 488.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(4-fluorophenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-(4-fluorophenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 126057492 |
| Molecular Formula | C22H12Cl2FN3O3S |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.00 |
| IUPAC Name | 2,4-dichloro-N-[4-(4-fluorophenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)c(-c2ccc([N+](=O)[O-])cc2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H12Cl2FN3O3S/c23-14-5-10-17(18(24)11-14)21(29)27-22-26-19(12-1-6-15(25)7-2-12)20(32-22)13-3-8-16(9-4-13)28(30)31/h1-11H,(H,26,27,29) |
| InChIKey | IIZPGNVEHARWIR-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|