C23H15N5O8S — CID 124544358
N-[4-(4-methoxyphenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]-2,4-dinitrobenzamide (PubChem CID 124544358) has the molecular formula C23H15N5O8S and a molecular weight of 521.47 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]-2,4-dinitrobenzamide.
| Compound Name | N-[4-(4-methoxyphenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 124544358 |
| Molecular Formula | C23H15N5O8S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]-2,4-dinitrobenzamide |
| SMILES | COc1ccc(-c2nc(NC(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])sc2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H15N5O8S/c1-36-17-9-4-13(5-10-17)20-21(14-2-6-15(7-3-14)26(30)31)37-23(24-20)25-22(29)18-11-8-16(27(32)33)12-19(18)28(34)35/h2-12H,1H3,(H,24,25,29) |
| InChIKey | OSRWWPQVRQHDFA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 180.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|