C28H20N6O12 — CID 3643668
N-[4-[4-[(2,4-dinitrobenzoyl)amino]-3-methoxyphenyl]-2-methoxyphenyl]-2,4-dinitrobenzamide (PubChem CID 3643668) has the molecular formula C28H20N6O12 and a molecular weight of 632.50 g/mol. Its IUPAC name is N-[4-[4-[(2,4-dinitrobenzoyl)amino]-3-methoxyphenyl]-2-methoxyphenyl]-2,4-dinitrobenzamide.
| Compound Name | N-[4-[4-[(2,4-dinitrobenzoyl)amino]-3-methoxyphenyl]-2-methoxyphenyl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 3643668 |
| Molecular Formula | C28H20N6O12 |
| Molecular Weight | 632.50 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | N-[4-[4-[(2,4-dinitrobenzoyl)amino]-3-methoxyphenyl]-2-methoxyphenyl]-2,4-dinitrobenzamide |
| SMILES | COc1cc(-c2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(OC)c2)ccc1NC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H20N6O12/c1-45-25-11-15(3-9-21(25)29-27(35)19-7-5-17(31(37)38)13-23(19)33(41)42)16-4-10-22(26(12-16)46-2)30-28(36)20-8-6-18(32(39)40)14-24(20)34(43)44/h3-14H,1-2H3,(H,29,35)(H,30,36) |
| InChIKey | YZUVOLJJVLWVGH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 249.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|