C15H12N4O9 — CID 17359269
2-(2,4-dinitrophenoxy)-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 17359269) has the molecular formula C15H12N4O9 and a molecular weight of 392.28 g/mol. Its IUPAC name is 2-(2,4-dinitrophenoxy)-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-(2,4-dinitrophenoxy)-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17359269 |
| Molecular Formula | C15H12N4O9 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-(2,4-dinitrophenoxy)-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12N4O9/c1-27-14-7-10(18(23)24)2-4-11(14)16-15(20)8-28-13-5-3-9(17(21)22)6-12(13)19(25)26/h2-7H,8H2,1H3,(H,16,20) |
| InChIKey | HTNSHDXYBMAYKO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 176.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|