C15H10N4O6 — CID 17359267
N-(2-cyanophenyl)-2-(2,4-dinitrophenoxy)acetamide (PubChem CID 17359267) has the molecular formula C15H10N4O6 and a molecular weight of 342.27 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(2,4-dinitrophenoxy)acetamide.
| Compound Name | N-(2-cyanophenyl)-2-(2,4-dinitrophenoxy)acetamide |
|---|---|
| PubChem CID | 17359267 |
| Molecular Formula | C15H10N4O6 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N-(2-cyanophenyl)-2-(2,4-dinitrophenoxy)acetamide |
| SMILES | N#Cc1ccccc1NC(=O)COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10N4O6/c16-8-10-3-1-2-4-12(10)17-15(20)9-25-14-6-5-11(18(21)22)7-13(14)19(23)24/h1-7H,9H2,(H,17,20) |
| InChIKey | HUBVPQQTLAHLPE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|