C8H5ClN2O6 — CID 15133534
2-(2,4-dinitrophenoxy)acetyl chloride (PubChem CID 15133534) has the molecular formula C8H5ClN2O6 and a molecular weight of 260.59 g/mol. Its IUPAC name is 2-(2,4-dinitrophenoxy)acetyl chloride.
| Compound Name | 2-(2,4-dinitrophenoxy)acetyl chloride |
|---|---|
| PubChem CID | 15133534 |
| Molecular Formula | C8H5ClN2O6 |
| Molecular Weight | 260.59 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 2-(2,4-dinitrophenoxy)acetyl chloride |
| SMILES | O=C(Cl)COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5ClN2O6/c9-8(12)4-17-7-2-1-5(10(13)14)3-6(7)11(15)16/h1-3H,4H2 |
| InChIKey | SUAUKJIXUYOKIA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.59 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|