C13H12N2O5 — CID 169253491
1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,4-dinitrobenzene (PubChem CID 169253491) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,4-dinitrobenzene.
| Compound Name | 1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 169253491 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,4-dinitrobenzene |
| SMILES | C=C/C=C(\C=C)COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N2O5/c1-3-5-10(4-2)9-20-13-7-6-11(14(16)17)8-12(13)15(18)19/h3-8H,1-2,9H2/b10-5+ |
| InChIKey | LPTDGQKWYZVDEU-BJMVGYQFSA-N |
| XLogP | 3.18 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|