C16H18N2O5 — CID 145367241
1-[(4E,6Z)-4-ethenylocta-4,6-dien-3-yl]oxy-2,4-dinitrobenzene (PubChem CID 145367241) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-[(4E,6Z)-4-ethenylocta-4,6-dien-3-yl]oxy-2,4-dinitrobenzene.
| Compound Name | 1-[(4E,6Z)-4-ethenylocta-4,6-dien-3-yl]oxy-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 145367241 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-[(4E,6Z)-4-ethenylocta-4,6-dien-3-yl]oxy-2,4-dinitrobenzene |
| SMILES | C=C/C(=C\C=C/C)C(CC)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N2O5/c1-4-7-8-12(5-2)15(6-3)23-16-10-9-13(17(19)20)11-14(16)18(21)22/h4-5,7-11,15H,2,6H2,1,3H3/b7-4-,12-8+ |
| InChIKey | HHTGLFZZWSSPRR-OTIJGBKASA-N |
| XLogP | 4.35 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|