About (2,4-dinitrophenyl) pentanoate
(2,4-dinitrophenyl) pentanoate (PubChem CID 71404931) has the molecular formula C11H12N2O6
and a molecular weight of 268.22 g/mol. Its IUPAC name is (2,4-dinitrophenyl) pentanoate.
Molecular Properties
| Compound Name | (2,4-dinitrophenyl) pentanoate |
| PubChem CID | 71404931 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (2,4-dinitrophenyl) pentanoate |
| SMILES | CCCCC(=O)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O6/c1-2-3-4-11(14)19-10-6-5-8(12(15)16)7-9(10)13(17)18/h5-7H,2-4H2,1H3 |
| InChIKey | UMAFKYBFJFIDSG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dinitrophenyl) pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dinitrophenyl) pentanoate?
The IUPAC name of (2,4-dinitrophenyl) pentanoate (CID 71404931) is (2,4-dinitrophenyl) pentanoate.
What is the SMILES notation for (2,4-dinitrophenyl) pentanoate?
The canonical SMILES for (2,4-dinitrophenyl) pentanoate is CCCCC(=O)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of (2,4-dinitrophenyl) pentanoate?
The InChIKey is UMAFKYBFJFIDSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O6/c1-2-3-4-11(14)19-10-6-5-8(12(15)16)7-9(10)13(17)18/h5-7H,2-4H2,1H3.
What are the key properties of (2,4-dinitrophenyl) pentanoate?
(2,4-dinitrophenyl) pentanoate has a molecular weight of 268.22 g/mol, XLogP of 2.60, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitrophenyl) pentanoate is sourced from PubChem (CID 71404931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).